UK K12 GCSE/A-Level: Year 13 A-Level Upper Sixth Chemistry - Organic Synthesis, Multi-Step Reactions

Learning Objectives

Upon completing this topic, students will be able to:

• Describe the principles of organic synthesis and the importance of multi-step reactions in the preparation of complex organic molecules.
• Explain the role of protecting groups, reagents, and catalysts in multi-step reactions.
• Design and predict the outcome of multi-step reactions, including the identification of potential side products and limitations.
• Evaluate the efficiency and selectivity of different multi-step reaction sequences.
• Apply knowledge of organic synthesis to the analysis of real-world examples and case studies.

Core Concepts

Organic synthesis is the process of constructing complex organic molecules from simpler precursors. Multi-step reactions are a crucial aspect of organic synthesis, allowing chemists to build complex molecules through a series of carefully planned and executed reactions. The key principles of multi-step reactions include:

• Protecting groups: These are functional groups that are temporarily introduced to a molecule to prevent unwanted reactions and protect sensitive functional groups. Protecting groups are essential in multi-step reactions, as they allow chemists to manipulate complex molecules without compromising their structure.
• Reagents: These are substances that are used to facilitate chemical reactions. In multi-step reactions, reagents are carefully selected to ensure that the desired reaction occurs while minimizing the formation of side products.
• Catalysts: These are substances that speed up chemical reactions without being consumed by the reaction. Catalysts are often used in multi-step reactions to improve efficiency and selectivity.
• Reaction conditions: These refer to the temperature, pressure, solvent, and other conditions under which a reaction is carried out. Reaction conditions can have a significant impact on the outcome of a multi-step reaction, and chemists must carefully control these conditions to achieve the desired result.

Worked Examples

Example 1: Synthesis of Aspirin

Aspirin is a widely used pain reliever that is synthesized through a multi-step reaction sequence. The first step involves the introduction of a protecting group to the salicylic acid molecule:

C6H4OH + BOC2O-C6H4OC(O)CH3 + H2O

In this reaction, the BOC (tert-butyloxycarbonyl) group is introduced to the salicylic acid molecule to protect the hydroxyl group. The next step involves the reaction of the protected salicylic acid molecule with acetic anhydride:

C6H4OC(O)CH3 + (CH3CO)2O-C6H4OC(O)CH2COCH3 + CH3COOH

In this reaction, the acetic anhydride molecule reacts with the protected salicylic acid molecule to form aspirin. The final step involves the removal of the protecting group:

C6H4OC(O)CH2COCH3 + HCl-C6H4OC(O)CH2COOH + CH3COCl

In this reaction, the protecting group is removed, and the aspirin molecule is formed.

Example 2: Synthesis of Penicillin

Penicillin is a widely used antibiotic that is synthesized through a multi-step reaction sequence. The first step involves the introduction of a protecting group to the penicillin acid molecule:

C8H11NO3S + BOC2O-C8H11NO3S-OC(O)CH3 + H2O

In this reaction, the BOC group is introduced to the penicillin acid molecule to protect the hydroxyl group. The next step involves the reaction of the protected penicillin acid molecule with benzyl bromide:

C8H11NO3S-OC(O)CH3 + C6H5CH2Br-C8H11NO3S-OC(O)CH2C6H5 + HBr

In this reaction, the benzyl bromide molecule reacts with the protected penicillin acid molecule to form penicillin. The final step involves the removal of the protecting group:

C8H11NO3S-OC(O)CH2C6H5 + HCl-C8H11NO3S-OC(O)CH2C6H5 + CH3COCl

In this reaction, the protecting group is removed, and the penicillin molecule is formed.

Common Misconceptions

• Many students assume that multi-step reactions are always efficient and selective, but in reality, they can be prone to side reactions and limitations.
• Some students believe that protecting groups are only used to protect sensitive functional groups, but they can also be used to prevent unwanted reactions and improve the efficiency of a reaction sequence.
• Others assume that reagents and catalysts are interchangeable, but in reality, they have specific roles and functions in multi-step reactions.
• Finally, some students believe that reaction conditions are not important in multi-step reactions, but in reality, they can have a significant impact on the outcome of a reaction sequence.

Exam Tips

• When designing a multi-step reaction sequence, consider the role of protecting groups, reagents, and catalysts in each step.
• Evaluate the efficiency and selectivity of different multi-step reaction sequences, considering factors such as yield, purity, and reaction conditions.
• Apply knowledge of organic synthesis to the analysis of real-world examples and case studies, considering factors such as the structure of the molecule, the reaction conditions, and the role of protecting groups, reagents, and catalysts.
• Use diagrams and flowcharts to illustrate the reaction sequence and identify potential side products and limitations.

MCQs with Explanations

MCQ 1 [F]

What is the primary function of a protecting group in a multi-step reaction sequence?

A) To prevent unwanted reactions B) To improve the efficiency of a reaction sequence C) To protect sensitive functional groups D) To increase the yield of a reaction

Correct answer: C) To protect sensitive functional groups

Why the distractors fail: A) Protecting groups can prevent unwanted reactions, but this is not their primary function. B) Protecting groups can improve the efficiency of a reaction sequence, but this is not their primary function. D) Protecting groups do not directly increase the yield of a reaction.

MCQ 2 [H]

What is the role of a catalyst in a multi-step reaction sequence?

A) To consume the reactants B) To speed up the reaction C) To slow down the reaction D) To prevent unwanted reactions

Correct answer: B) To speed up the reaction

Why the distractors fail: A) Catalysts do not consume the reactants; they speed up the reaction. C) Catalysts do not slow down the reaction; they speed up the reaction. D) Catalysts do not prevent unwanted reactions; they speed up the reaction.

MCQ 3 [F]

What is the purpose of reaction conditions in a multi-step reaction sequence?

A) To improve the efficiency of a reaction sequence B) To increase the yield of a reaction C) To prevent unwanted reactions D) To control the reaction rate

Correct answer: D) To control the reaction rate

Why the distractors fail: A) Reaction conditions can improve the efficiency of a reaction sequence, but this is not their primary purpose. B) Reaction conditions do not directly increase the yield of a reaction. C) Reaction conditions can prevent unwanted reactions, but this is not their primary purpose.

MCQ 4 [H]

What is the difference between a reagent and a catalyst in a multi-step reaction sequence?

A) A reagent is a substance that speeds up a reaction, while a catalyst is a substance that consumes the reactants. B) A reagent is a substance that consumes the reactants, while a catalyst is a substance that speeds up the reaction. C) A reagent is a substance that speeds up a reaction, while a catalyst is a substance that slows down the reaction. D) A reagent is a substance that prevents unwanted reactions, while a catalyst is a substance that speeds up the reaction.

Correct answer: B) A reagent is a substance that consumes the reactants, while a catalyst is a substance that speeds up the reaction.

Why the distractors fail: A) Reagents do not speed up reactions; they consume the reactants. C) Catalysts do not slow down reactions; they speed up the reaction. D) Reagents do not prevent unwanted reactions; they consume the reactants.

MCQ 5 [H]

What is the significance of the yield of a reaction in a multi-step reaction sequence?

A) It indicates the efficiency of the reaction sequence B) It indicates the purity of the product C) It indicates the reaction rate D) It indicates the number of side products

Correct answer: A) It indicates the efficiency of the reaction sequence

Why the distractors fail: B) The yield of a reaction does not directly indicate the purity of the product. C) The yield of a reaction does not indicate the reaction rate. D) The yield of a reaction does not indicate the number of side products.

Short-answer Questions

1. Describe the role of protecting groups in a multi-step reaction sequence. Provide an example of a protecting group and its function in a reaction sequence.

Answer: Protecting groups are functional groups that are temporarily introduced to a molecule to prevent unwanted reactions and protect sensitive functional groups. An example of a protecting group is the BOC (tert-butyloxycarbonyl) group, which is used to protect the hydroxyl group in the synthesis of aspirin.

1. Explain the difference between a reagent and a catalyst in a multi-step reaction sequence. Provide an example of a reagent and a catalyst in a reaction sequence.

Answer: A reagent is a substance that consumes the reactants, while a catalyst is a substance that speeds up the reaction. An example of a reagent is acetic anhydride, which consumes the reactants in the synthesis of aspirin. An example of a catalyst is palladium, which speeds up the reaction in the synthesis of penicillin.

1. Describe the significance of reaction conditions in a multi-step reaction sequence. Provide an example of how reaction conditions can affect the outcome of a reaction sequence.

Answer: Reaction conditions refer to the temperature, pressure, solvent, and other conditions under which a reaction is carried out. Reaction conditions can have a significant impact on the outcome of a reaction sequence, and chemists must carefully control these conditions to achieve the desired result. For example, in the synthesis of aspirin, the reaction conditions can affect the yield and purity of the product.

1. Explain the importance of evaluating the efficiency and selectivity of different multi-step reaction sequences. Provide an example of how to evaluate the efficiency and selectivity of a reaction sequence.

Answer: Evaluating the efficiency and selectivity of different multi-step reaction sequences is crucial in organic synthesis, as it allows chemists to identify the most efficient and selective reaction sequence for a particular molecule. To evaluate the efficiency and selectivity of a reaction sequence, chemists can use metrics such as yield, purity, and reaction conditions. For example, in the synthesis of penicillin, chemists can evaluate the efficiency and selectivity of different reaction sequences by measuring the yield and purity of the product.

1. Describe the role of organic synthesis in the development of new medicines and materials. Provide an example of a new medicine or material that was developed through organic synthesis.

Answer: Organic synthesis plays a crucial role in the development of new medicines and materials, as it allows chemists to design and synthesize complex molecules with specific properties. An example of a new medicine that was developed through organic synthesis is the antibiotic penicillin, which was synthesized through a multi-step reaction sequence.